C34H36N2 — CID 23526005
N-ethyl-4-[1-[4-[ethyl(methyl)amino]phenyl]-4,4-diphenylbuta-1,3-dienyl]-N-methylaniline (PubChem CID 23526005) has the molecular formula C34H36N2 and a molecular weight of 472.68 g/mol. Its IUPAC name is N-ethyl-4-[1-[4-[ethyl(methyl)amino]phenyl]-4,4-diphenylbuta-1,3-dienyl]-N-methylaniline.
| Compound Name | N-ethyl-4-[1-[4-[ethyl(methyl)amino]phenyl]-4,4-diphenylbuta-1,3-dienyl]-N-methylaniline |
|---|---|
| PubChem CID | 23526005 |
| Molecular Formula | C34H36N2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | N-ethyl-4-[1-[4-[ethyl(methyl)amino]phenyl]-4,4-diphenylbuta-1,3-dienyl]-N-methylaniline |
| SMILES | CCN(C)c1ccc(C(=CC=C(c2ccccc2)c2ccccc2)c2ccc(N(C)CC)cc2)cc1 |
| InChI | InChI=1S/C34H36N2/c1-5-35(3)31-21-17-29(18-22-31)34(30-19-23-32(24-20-30)36(4)6-2)26-25-33(27-13-9-7-10-14-27)28-15-11-8-12-16-28/h7-26H,5-6H2,1-4H3 |
| InChIKey | XSTGMRUPPFMLGY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|