About [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 2352610) has the molecular formula C14H13NO5
and a molecular weight of 275.26 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate.
Molecular Properties
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate |
| PubChem CID | 2352610 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1O)NCc1ccco1 |
| InChI | InChI=1S/C14H13NO5/c16-12-6-2-1-5-11(12)14(18)20-9-13(17)15-8-10-4-3-7-19-10/h1-7,16H,8-9H2,(H,15,17) |
| InChIKey | QOJOPFOHBCGESI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate?
The IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate (CID 2352610) is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate.
What is the SMILES notation for [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate?
The canonical SMILES for [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate is O=C(COC(=O)c1ccccc1O)NCc1ccco1.
What is the InChIKey of [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate?
The InChIKey is QOJOPFOHBCGESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO5/c16-12-6-2-1-5-11(12)14(18)20-9-13(17)15-8-10-4-3-7-19-10/h1-7,16H,8-9H2,(H,15,17).
What are the key properties of [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate?
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate has a molecular weight of 275.26 g/mol, XLogP of 1.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-hydroxybenzoate is sourced from PubChem (CID 2352610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).