C48H68N2O6 — CID 23526118
5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 23526118) has the molecular formula C48H68N2O6 and a molecular weight of 769.08 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23526118 |
| Molecular Formula | C48H68N2O6 |
| Molecular Weight | 769.08 g/mol |
| Exact Mass | 768.51 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)(C)c1cc(CN2C(=O)C(c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C(=O)N(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C48H68N2O6/c1-43(2,3)30-19-27(20-31(37(30)51)44(4,5)6)25-49-40(54)36(29-23-34(47(13,14)15)39(53)35(24-29)48(16,17)18)41(55)50(42(49)56)26-28-21-32(45(7,8)9)38(52)33(22-28)46(10,11)12/h19-24,36,51-53H,25-26H2,1-18H3 |
| InChIKey | AZZHVDBXXXADNB-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.08 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|