C47H36N6 — CID 23526209
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 23526209) has the molecular formula C47H36N6 and a molecular weight of 684.85 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 23526209 |
| Molecular Formula | C47H36N6 |
| Molecular Weight | 684.85 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CCC1(CC)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C47H36N6/c1-3-47(4-2)39-29-35(45-50-41(31-17-9-5-10-18-31)48-42(51-45)32-19-11-6-12-20-32)25-27-37(39)38-28-26-36(30-40(38)47)46-52-43(33-21-13-7-14-22-33)49-44(53-46)34-23-15-8-16-24-34/h5-30H,3-4H2,1-2H3 |
| InChIKey | KBXNLYVFCUBPDD-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.85 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |