About 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one
7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one (PubChem CID 23526228) has the molecular formula C20H20N2O2S
and a molecular weight of 352.46 g/mol. Its IUPAC name is 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one.
Molecular Properties
| Compound Name | 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one |
| PubChem CID | 23526228 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(C3Nc4ccccc4S3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H20N2O2S/c1-3-22(4-2)14-10-9-13-11-15(20(23)24-17(13)12-14)19-21-16-7-5-6-8-18(16)25-19/h5-12,19,21H,3-4H2,1-2H3 |
| InChIKey | LSTGCKPVZRBVQU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one?
The IUPAC name of 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one (CID 23526228) is 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one.
What is the SMILES notation for 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one?
The canonical SMILES for 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one is CCN(CC)c1ccc2cc(C3Nc4ccccc4S3)c(=O)oc2c1.
What is the InChIKey of 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one?
The InChIKey is LSTGCKPVZRBVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2S/c1-3-22(4-2)14-10-9-13-11-15(20(23)24-17(13)12-14)19-21-16-7-5-6-8-18(16)25-19/h5-12,19,21H,3-4H2,1-2H3.
What are the key properties of 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one?
7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one has a molecular weight of 352.46 g/mol, XLogP of 4.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(diethylamino)-3-(2,3-dihydro-1,3-benzothiazol-2-yl)chromen-2-one is sourced from PubChem (CID 23526228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).