About [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2352633) has the molecular formula C21H22N2O8S
and a molecular weight of 462.48 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| PubChem CID | 2352633 |
| Molecular Formula | C21H22N2O8S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)OCO3)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H22N2O8S/c1-14-2-3-15(10-19(14)32(26,27)23-6-8-28-9-7-23)21(25)29-12-20(24)22-16-4-5-17-18(11-16)31-13-30-17/h2-5,10-11H,6-9,12-13H2,1H3,(H,22,24) |
| InChIKey | RWAAMZPVBGGUAU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate?
The IUPAC name of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate (CID 2352633) is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
What is the SMILES notation for [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate?
The canonical SMILES for [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate is Cc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)OCO3)cc1S(=O)(=O)N1CCOCC1.
What is the InChIKey of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate?
The InChIKey is RWAAMZPVBGGUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O8S/c1-14-2-3-15(10-19(14)32(26,27)23-6-8-28-9-7-23)21(25)29-12-20(24)22-16-4-5-17-18(11-16)31-13-30-17/h2-5,10-11H,6-9,12-13H2,1H3,(H,22,24).
What are the key properties of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate?
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate has a molecular weight of 462.48 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate is sourced from PubChem (CID 2352633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).