About (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline
(Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline (PubChem CID 23526361) has the molecular formula C19H17IrN2O2-
and a molecular weight of 497.57 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline.
Molecular Properties
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline |
| PubChem CID | 23526361 |
| Molecular Formula | C19H17IrN2O2- |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1ccccc1-c1cnc2ccccc2n1 |
| InChI | InChI=1S/C14H9N2.C5H8O2.Ir/c1-2-6-11(7-3-1)14-10-15-12-8-4-5-9-13(12)16-14;1-4(6)3-5(2)7;/h1-6,8-10H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | CJLWWKKCVFAOLH-LWFKIUJUSA-N |
| XLogP | 4.13 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline?
The IUPAC name of (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline (CID 23526361) is (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline.
What is the SMILES notation for (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline?
The canonical SMILES for (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline is CC(=O)/C=C(/C)O.[Ir].[c-]1ccccc1-c1cnc2ccccc2n1.
What is the InChIKey of (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline?
The InChIKey is CJLWWKKCVFAOLH-LWFKIUJUSA-N. The full InChI is InChI=1S/C14H9N2.C5H8O2.Ir/c1-2-6-11(7-3-1)14-10-15-12-8-4-5-9-13(12)16-14;1-4(6)3-5(2)7;/h1-6,8-10H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline?
(Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline has a molecular weight of 497.57 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxypent-3-en-2-one;iridium;2-phenylquinoxaline is sourced from PubChem (CID 23526361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).