About 2-thiophen-2-yl-1,2-dihydroquinoline
2-thiophen-2-yl-1,2-dihydroquinoline (PubChem CID 23526375) has the molecular formula C13H11NS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,2-dihydroquinoline.
Molecular Properties
| Compound Name | 2-thiophen-2-yl-1,2-dihydroquinoline |
| PubChem CID | 23526375 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-thiophen-2-yl-1,2-dihydroquinoline |
| SMILES | C1=CC(c2cccs2)Nc2ccccc21 |
| InChI | InChI=1S/C13H11NS/c1-2-5-11-10(4-1)7-8-12(14-11)13-6-3-9-15-13/h1-9,12,14H |
| InChIKey | QXERJAIRONURCY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-thiophen-2-yl-1,2-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-yl-1,2-dihydroquinoline?
The IUPAC name of 2-thiophen-2-yl-1,2-dihydroquinoline (CID 23526375) is 2-thiophen-2-yl-1,2-dihydroquinoline.
What is the SMILES notation for 2-thiophen-2-yl-1,2-dihydroquinoline?
The canonical SMILES for 2-thiophen-2-yl-1,2-dihydroquinoline is C1=CC(c2cccs2)Nc2ccccc21.
What is the InChIKey of 2-thiophen-2-yl-1,2-dihydroquinoline?
The InChIKey is QXERJAIRONURCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NS/c1-2-5-11-10(4-1)7-8-12(14-11)13-6-3-9-15-13/h1-9,12,14H.
What are the key properties of 2-thiophen-2-yl-1,2-dihydroquinoline?
2-thiophen-2-yl-1,2-dihydroquinoline has a molecular weight of 213.31 g/mol, XLogP of 3.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-yl-1,2-dihydroquinoline is sourced from PubChem (CID 23526375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).