About iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine
iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine (PubChem CID 23526404) has the molecular formula C10H5F3IrNS-
and a molecular weight of 420.44 g/mol. Its IUPAC name is iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine |
| PubChem CID | 23526404 |
| Molecular Formula | C10H5F3IrNS- |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(-c2[c-]ccs2)nc1.[Ir] |
| InChI | InChI=1S/C10H5F3NS.Ir/c11-10(12,13)7-3-4-8(14-6-7)9-2-1-5-15-9;/h1,3-6H;/q-1; |
| InChIKey | CBWSRDQXSHFXOC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine?
The IUPAC name of iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine (CID 23526404) is iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine.
What is the SMILES notation for iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine?
The canonical SMILES for iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine is FC(F)(F)c1ccc(-c2[c-]ccs2)nc1.[Ir].
What is the InChIKey of iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine?
The InChIKey is CBWSRDQXSHFXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3NS.Ir/c11-10(12,13)7-3-4-8(14-6-7)9-2-1-5-15-9;/h1,3-6H;/q-1;.
What are the key properties of iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine?
iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine has a molecular weight of 420.44 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-(3H-thiophen-3-id-2-yl)-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 23526404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).