About [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate
[2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 2352642) has the molecular formula C16H11Cl2FO4
and a molecular weight of 357.16 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
| PubChem CID | 2352642 |
| Molecular Formula | C16H11Cl2FO4 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11Cl2FO4/c17-11-3-6-15(13(18)7-11)22-9-16(21)23-8-14(20)10-1-4-12(19)5-2-10/h1-7H,8-9H2 |
| InChIKey | KGBNCQPVQZMNLA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate?
The IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate (CID 2352642) is [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate.
What is the SMILES notation for [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate?
The canonical SMILES for [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate is O=C(COc1ccc(Cl)cc1Cl)OCC(=O)c1ccc(F)cc1.
What is the InChIKey of [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate?
The InChIKey is KGBNCQPVQZMNLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2FO4/c17-11-3-6-15(13(18)7-11)22-9-16(21)23-8-14(20)10-1-4-12(19)5-2-10/h1-7H,8-9H2.
What are the key properties of [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate?
[2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate has a molecular weight of 357.16 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate is sourced from PubChem (CID 2352642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).