C30H29N3O2 — CID 23526450
(2Z)-2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 23526450) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (2Z)-2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 23526450 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (2Z)-2-[2-[(E)-2-(1-benzyl-8-methoxy-4,4-dimethyl-2,3-dihydroquinolin-6-yl)ethenyl]-6-methylpyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C(C)OC(/C=C/c2cc(OC)c3c(c2)C(C)(C)CCN3Cc2ccccc2)=C1 |
| InChI | InChI=1S/C30H29N3O2/c1-21-15-24(27(19-31)32-4)18-25(35-21)12-11-23-16-26-29(28(17-23)34-5)33(14-13-30(26,2)3)20-22-9-7-6-8-10-22/h6-12,15-18H,13-14,20H2,1-3,5H3/b12-11+,27-24- |
| InChIKey | LGBALVODIUBWAP-HNZCFKALSA-N |
| XLogP | 6.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|