C17H16N4O2S — CID 2352685
N-(4-phenylmethoxyphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 2352685) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-(4-phenylmethoxyphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-(4-phenylmethoxyphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2352685 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(4-phenylmethoxyphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1ncn[nH]1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c22-16(11-24-17-18-12-19-21-17)20-14-6-8-15(9-7-14)23-10-13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,20,22)(H,18,19,21) |
| InChIKey | DGZHCSUGBYNGPE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |