C23H31N5O3 — CID 23527107
8-(cyclohexylamino)-1,3-diethyl-7-[(3-methoxyphenyl)methyl]purine-2,6-dione (PubChem CID 23527107) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 8-(cyclohexylamino)-1,3-diethyl-7-[(3-methoxyphenyl)methyl]purine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-1,3-diethyl-7-[(3-methoxyphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 23527107 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 8-(cyclohexylamino)-1,3-diethyl-7-[(3-methoxyphenyl)methyl]purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(NC3CCCCC3)n2Cc2cccc(OC)c2)n(CC)c1=O |
| InChI | InChI=1S/C23H31N5O3/c1-4-26-20-19(21(29)27(5-2)23(26)30)28(15-16-10-9-13-18(14-16)31-3)22(25-20)24-17-11-7-6-8-12-17/h9-10,13-14,17H,4-8,11-12,15H2,1-3H3,(H,24,25) |
| InChIKey | KBUQLIFMRQMDGG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |