About [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate
[4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate (PubChem CID 23527498) has the molecular formula C33H34F2O2
and a molecular weight of 500.63 g/mol. Its IUPAC name is [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate.
Molecular Properties
| Compound Name | [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate |
| PubChem CID | 23527498 |
| Molecular Formula | C33H34F2O2 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(c2ccc(-c3ccc4c(c3)C(F)(F)c3cc(CCCCC)ccc3-4)cc2)CC1 |
| InChI | InChI=1S/C33H34F2O2/c1-3-5-6-7-22-8-18-28-29-19-15-26(21-31(29)33(34,35)30(28)20-22)25-11-9-23(10-12-25)24-13-16-27(17-14-24)37-32(36)4-2/h4,8-12,15,18-21,24,27H,2-3,5-7,13-14,16-17H2,1H3 |
| InChIKey | SGZJKCFLBIQUKJ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate?
The IUPAC name of [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate (CID 23527498) is [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate.
What is the SMILES notation for [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate?
The canonical SMILES for [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate is C=CC(=O)OC1CCC(c2ccc(-c3ccc4c(c3)C(F)(F)c3cc(CCCCC)ccc3-4)cc2)CC1.
What is the InChIKey of [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate?
The InChIKey is SGZJKCFLBIQUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34F2O2/c1-3-5-6-7-22-8-18-28-29-19-15-26(21-31(29)33(34,35)30(28)20-22)25-11-9-23(10-12-25)24-13-16-27(17-14-24)37-32(36)4-2/h4,8-12,15,18-21,24,27H,2-3,5-7,13-14,16-17H2,1H3.
What are the key properties of [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate?
[4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate has a molecular weight of 500.63 g/mol, XLogP of 8.96, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(9,9-difluoro-7-pentylfluoren-2-yl)phenyl]cyclohexyl] prop-2-enoate is sourced from PubChem (CID 23527498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).