C37H40N2O4 — CID 23527512
2-(3-ethenoxypropoxy)-5-[2-[7-[2-[5-(3-ethenoxypropoxy)-2-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]pyridine (PubChem CID 23527512) has the molecular formula C37H40N2O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is 2-(3-ethenoxypropoxy)-5-[2-[7-[2-[5-(3-ethenoxypropoxy)-2-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]pyridine.
| Compound Name | 2-(3-ethenoxypropoxy)-5-[2-[7-[2-[5-(3-ethenoxypropoxy)-2-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 23527512 |
| Molecular Formula | C37H40N2O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 2-(3-ethenoxypropoxy)-5-[2-[7-[2-[5-(3-ethenoxypropoxy)-2-pyridinyl]ethyl]-9H-fluoren-2-yl]ethyl]pyridine |
| SMILES | C=COCCCOc1ccc(CCc2ccc3c(c2)Cc2cc(CCc4ccc(OCCCOC=C)nc4)ccc2-3)nc1 |
| InChI | InChI=1S/C37H40N2O4/c1-3-40-19-5-21-42-34-15-14-33(38-27-34)13-9-29-11-17-36-32(24-29)25-31-23-28(10-16-35(31)36)7-8-30-12-18-37(39-26-30)43-22-6-20-41-4-2/h3-4,10-12,14-18,23-24,26-27H,1-2,5-9,13,19-22,25H2 |
| InChIKey | FJMGJZXUPAYSGR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|