About [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate (PubChem CID 2352753) has the molecular formula C14H10F3NO3S
and a molecular weight of 329.30 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate |
| PubChem CID | 2352753 |
| Molecular Formula | C14H10F3NO3S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate |
| SMILES | O=C(COC(=O)Cc1cccs1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H10F3NO3S/c15-9-3-4-10(14(17)13(9)16)18-11(19)7-21-12(20)6-8-2-1-5-22-8/h1-5H,6-7H2,(H,18,19) |
| InChIKey | YKHVBWHVBVDQBD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate?
The IUPAC name of [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate (CID 2352753) is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate.
What is the SMILES notation for [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate?
The canonical SMILES for [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate is O=C(COC(=O)Cc1cccs1)Nc1ccc(F)c(F)c1F.
What is the InChIKey of [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate?
The InChIKey is YKHVBWHVBVDQBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO3S/c15-9-3-4-10(14(17)13(9)16)18-11(19)7-21-12(20)6-8-2-1-5-22-8/h1-5H,6-7H2,(H,18,19).
What are the key properties of [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate?
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate has a molecular weight of 329.30 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-thiophen-2-ylacetate is sourced from PubChem (CID 2352753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).