C39H28N4 — CID 23527761
4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline (PubChem CID 23527761) has the molecular formula C39H28N4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 23527761 |
| Molecular Formula | C39H28N4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N,N-diphenylaniline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C39H28N4/c1-5-13-31(14-6-1)37-40-38(32-15-7-2-8-16-32)42-39(41-37)33-23-21-29(22-24-33)30-25-27-36(28-26-30)43(34-17-9-3-10-18-34)35-19-11-4-12-20-35/h1-28H |
| InChIKey | CRPHNAQJTBMXGX-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |