C37H26N4 — CID 23527778
6-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylnaphthalen-2-amine (PubChem CID 23527778) has the molecular formula C37H26N4 and a molecular weight of 526.64 g/mol. Its IUPAC name is 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylnaphthalen-2-amine.
| Compound Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylnaphthalen-2-amine |
|---|---|
| PubChem CID | 23527778 |
| Molecular Formula | C37H26N4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylnaphthalen-2-amine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4cc(N(c5ccccc5)c5ccccc5)ccc4c3)n2)cc1 |
| InChI | InChI=1S/C37H26N4/c1-5-13-27(14-6-1)35-38-36(28-15-7-2-8-16-28)40-37(39-35)31-22-21-30-26-34(24-23-29(30)25-31)41(32-17-9-3-10-18-32)33-19-11-4-12-20-33/h1-26H |
| InChIKey | JEXZQDUGUUYXHY-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |