C9H10N2S — CID 23527869
3,5-dimethyl-1-thiophen-2-ylpyrazole (PubChem CID 23527869) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 3,5-dimethyl-1-thiophen-2-ylpyrazole.
| Compound Name | 3,5-dimethyl-1-thiophen-2-ylpyrazole |
|---|---|
| PubChem CID | 23527869 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3,5-dimethyl-1-thiophen-2-ylpyrazole |
| SMILES | Cc1cc(C)n(-c2cccs2)n1 |
| InChI | InChI=1S/C9H10N2S/c1-7-6-8(2)11(10-7)9-4-3-5-12-9/h3-6H,1-2H3 |
| InChIKey | TVKCWAXLFBBCAD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |