About carbanide;iridium;2-thiophen-2-ylpyridine
carbanide;iridium;2-thiophen-2-ylpyridine (PubChem CID 23527880) has the molecular formula C11H13IrNS-2
and a molecular weight of 383.52 g/mol. Its IUPAC name is carbanide;iridium;2-thiophen-2-ylpyridine.
Molecular Properties
| Compound Name | carbanide;iridium;2-thiophen-2-ylpyridine |
| PubChem CID | 23527880 |
| Molecular Formula | C11H13IrNS-2 |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | carbanide;iridium;2-thiophen-2-ylpyridine |
| SMILES | [CH3-].[CH3-].[Ir].c1ccc(-c2cccs2)nc1 |
| InChI | InChI=1S/C9H7NS.2CH3.Ir/c1-2-6-10-8(4-1)9-5-3-7-11-9;;;/h1-7H;2*1H3;/q;2*-1; |
| InChIKey | YQTJDEADRIZOIG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;iridium;2-thiophen-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;iridium;2-thiophen-2-ylpyridine?
The IUPAC name of carbanide;iridium;2-thiophen-2-ylpyridine (CID 23527880) is carbanide;iridium;2-thiophen-2-ylpyridine.
What is the SMILES notation for carbanide;iridium;2-thiophen-2-ylpyridine?
The canonical SMILES for carbanide;iridium;2-thiophen-2-ylpyridine is [CH3-].[CH3-].[Ir].c1ccc(-c2cccs2)nc1.
What is the InChIKey of carbanide;iridium;2-thiophen-2-ylpyridine?
The InChIKey is YQTJDEADRIZOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS.2CH3.Ir/c1-2-6-10-8(4-1)9-5-3-7-11-9;;;/h1-7H;2*1H3;/q;2*-1;.
What are the key properties of carbanide;iridium;2-thiophen-2-ylpyridine?
carbanide;iridium;2-thiophen-2-ylpyridine has a molecular weight of 383.52 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;iridium;2-thiophen-2-ylpyridine is sourced from PubChem (CID 23527880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).