C11H6F12O2 — CID 23528219
1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopenta-1,3-dien-1-yl]propan-2-ol (PubChem CID 23528219) has the molecular formula C11H6F12O2 and a molecular weight of 398.14 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopenta-1,3-dien-1-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopenta-1,3-dien-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 23528219 |
| Molecular Formula | C11H6F12O2 |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclopenta-1,3-dien-1-yl]propan-2-ol |
| SMILES | OC(C1=C(C(O)(C(F)(F)F)C(F)(F)F)CC=C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F12O2/c12-8(13,14)6(24,9(15,16)17)4-2-1-3-5(4)7(25,10(18,19)20)11(21,22)23/h1-2,24-25H,3H2 |
| InChIKey | UXCJODMBUIHFCW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |