C13H10F10O — CID 23528221
2-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 23528221) has the molecular formula C13H10F10O and a molecular weight of 372.20 g/mol. Its IUPAC name is 2-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 23528221 |
| Molecular Formula | C13H10F10O |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)c1c(F)c(F)c(C(O)(C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H10F10O/c1-3-4(2)5-7(14)9(16)6(10(17)8(5)15)11(24,12(18,19)20)13(21,22)23/h4,24H,3H2,1-2H3 |
| InChIKey | DZQGMRCPGOACMB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|