C18H22F6O2 — CID 23528251
[2-(4-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2,2-dimethylpropanoate (PubChem CID 23528251) has the molecular formula C18H22F6O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is [2-(4-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [2-(4-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 23528251 |
| Molecular Formula | C18H22F6O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [2-(4-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCC(C)c1ccc(C(OC(=O)C(C)(C)C)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H22F6O2/c1-6-11(2)12-7-9-13(10-8-12)16(17(19,20)21,18(22,23)24)26-14(25)15(3,4)5/h7-11H,6H2,1-5H3 |
| InChIKey | UTRPLYICJOMNSE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |