About 5-chloroindeno[1,2-c]isoquinolin-11-one
5-chloroindeno[1,2-c]isoquinolin-11-one (PubChem CID 23529066) has the molecular formula C16H8ClNO
and a molecular weight of 265.70 g/mol. Its IUPAC name is 5-chloroindeno[1,2-c]isoquinolin-11-one.
Molecular Properties
| Compound Name | 5-chloroindeno[1,2-c]isoquinolin-11-one |
| PubChem CID | 23529066 |
| Molecular Formula | C16H8ClNO |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 5-chloroindeno[1,2-c]isoquinolin-11-one |
| SMILES | O=C1c2ccccc2-c2nc(Cl)c3ccccc3c21 |
| InChI | InChI=1S/C16H8ClNO/c17-16-12-8-4-1-5-9(12)13-14(18-16)10-6-2-3-7-11(10)15(13)19/h1-8H |
| InChIKey | HOMCJNVRVANJPW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloroindeno[1,2-c]isoquinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloroindeno[1,2-c]isoquinolin-11-one?
The IUPAC name of 5-chloroindeno[1,2-c]isoquinolin-11-one (CID 23529066) is 5-chloroindeno[1,2-c]isoquinolin-11-one.
What is the SMILES notation for 5-chloroindeno[1,2-c]isoquinolin-11-one?
The canonical SMILES for 5-chloroindeno[1,2-c]isoquinolin-11-one is O=C1c2ccccc2-c2nc(Cl)c3ccccc3c21.
What is the InChIKey of 5-chloroindeno[1,2-c]isoquinolin-11-one?
The InChIKey is HOMCJNVRVANJPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8ClNO/c17-16-12-8-4-1-5-9(12)13-14(18-16)10-6-2-3-7-11(10)15(13)19/h1-8H.
What are the key properties of 5-chloroindeno[1,2-c]isoquinolin-11-one?
5-chloroindeno[1,2-c]isoquinolin-11-one has a molecular weight of 265.70 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloroindeno[1,2-c]isoquinolin-11-one is sourced from PubChem (CID 23529066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).