C27H27Br2N5O4 — CID 23529131
3,4-bis[1-[2-(2-bromoethoxy)ethyl]pyrrolo[2,3-b]pyridin-3-yl]-1-methylpyrrole-2,5-dione (PubChem CID 23529131) has the molecular formula C27H27Br2N5O4 and a molecular weight of 645.35 g/mol. Its IUPAC name is 3,4-bis[1-[2-(2-bromoethoxy)ethyl]pyrrolo[2,3-b]pyridin-3-yl]-1-methylpyrrole-2,5-dione.
| Compound Name | 3,4-bis[1-[2-(2-bromoethoxy)ethyl]pyrrolo[2,3-b]pyridin-3-yl]-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 23529131 |
| Molecular Formula | C27H27Br2N5O4 |
| Molecular Weight | 645.35 g/mol |
| Exact Mass | 643.04 |
| IUPAC Name | 3,4-bis[1-[2-(2-bromoethoxy)ethyl]pyrrolo[2,3-b]pyridin-3-yl]-1-methylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2cn(CCOCCBr)c3ncccc23)=C(c2cn(CCOCCBr)c3ncccc23)C1=O |
| InChI | InChI=1S/C27H27Br2N5O4/c1-32-26(35)22(20-16-33(10-14-37-12-6-28)24-18(20)4-2-8-30-24)23(27(32)36)21-17-34(11-15-38-13-7-29)25-19(21)5-3-9-31-25/h2-5,8-9,16-17H,6-7,10-15H2,1H3 |
| InChIKey | ZMIYNGKVNNAAET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|