C28H30N6O5 — CID 23529143
20-(2-hydroxyethyl)-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione (PubChem CID 23529143) has the molecular formula C28H30N6O5 and a molecular weight of 530.59 g/mol. Its IUPAC name is 20-(2-hydroxyethyl)-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione.
| Compound Name | 20-(2-hydroxyethyl)-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione |
|---|---|
| PubChem CID | 23529143 |
| Molecular Formula | C28H30N6O5 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 20-(2-hydroxyethyl)-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione |
| SMILES | O=C1NC(=O)C2=C1c1cn(c3ncccc13)CCOCCN(CCO)CCOCCn1cc2c2cccnc21 |
| InChI | InChI=1S/C28H30N6O5/c35-12-7-32-8-13-38-15-10-33-17-21(19-3-1-5-29-25(19)33)23-24(28(37)31-27(23)36)22-18-34(11-16-39-14-9-32)26-20(22)4-2-6-30-26/h1-6,17-18,35H,7-16H2,(H,31,36,37) |
| InChIKey | AUNQPXLKLBUVNH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|