C23H22N2O6 — CID 23529310
(2R)-2-[4-[[[2-(3-methoxyphenoxy)pyridine-3-carbonyl]amino]methyl]phenoxy]propanoic acid (PubChem CID 23529310) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is (2R)-2-[4-[[[2-(3-methoxyphenoxy)pyridine-3-carbonyl]amino]methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[[[2-(3-methoxyphenoxy)pyridine-3-carbonyl]amino]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 23529310 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (2R)-2-[4-[[[2-(3-methoxyphenoxy)pyridine-3-carbonyl]amino]methyl]phenoxy]propanoic acid |
| SMILES | COc1cccc(Oc2ncccc2C(=O)NCc2ccc(O[C@H](C)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H22N2O6/c1-15(23(27)28)30-17-10-8-16(9-11-17)14-25-21(26)20-7-4-12-24-22(20)31-19-6-3-5-18(13-19)29-2/h3-13,15H,14H2,1-2H3,(H,25,26)(H,27,28)/t15-/m1/s1 |
| InChIKey | UNAILWSHMZYTQC-OAHLLOKOSA-N |
| XLogP | 3.66 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |