About 3,6-dioxocyclohexa-1,4-dien-1-olate
3,6-dioxocyclohexa-1,4-dien-1-olate (PubChem CID 23529530) has the molecular formula C6H3O3-
and a molecular weight of 123.09 g/mol. Its IUPAC name is 3,6-dioxocyclohexa-1,4-dien-1-olate.
Molecular Properties
| Compound Name | 3,6-dioxocyclohexa-1,4-dien-1-olate |
| PubChem CID | 23529530 |
| Molecular Formula | C6H3O3- |
| Molecular Weight | 123.09 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | 3,6-dioxocyclohexa-1,4-dien-1-olate |
| SMILES | O=C1C=CC(=O)C([O-])=C1 |
| InChI | InChI=1S/C6H4O3/c7-4-1-2-5(8)6(9)3-4/h1-3,9H/p-1 |
| InChIKey | GPLIMIJPIZGPIF-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.09 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dioxocyclohexa-1,4-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dioxocyclohexa-1,4-dien-1-olate?
The IUPAC name of 3,6-dioxocyclohexa-1,4-dien-1-olate (CID 23529530) is 3,6-dioxocyclohexa-1,4-dien-1-olate.
What is the SMILES notation for 3,6-dioxocyclohexa-1,4-dien-1-olate?
The canonical SMILES for 3,6-dioxocyclohexa-1,4-dien-1-olate is O=C1C=CC(=O)C([O-])=C1.
What is the InChIKey of 3,6-dioxocyclohexa-1,4-dien-1-olate?
The InChIKey is GPLIMIJPIZGPIF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4O3/c7-4-1-2-5(8)6(9)3-4/h1-3,9H/p-1.
What are the key properties of 3,6-dioxocyclohexa-1,4-dien-1-olate?
3,6-dioxocyclohexa-1,4-dien-1-olate has a molecular weight of 123.09 g/mol, XLogP of -1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dioxocyclohexa-1,4-dien-1-olate is sourced from PubChem (CID 23529530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).