C11H8F16O3 — CID 23529538
2-[difluoro(1,1,2-trifluoropropoxy)methyl]-1,1,1,2,4,4,4-heptafluoro-3-(1,2,2,2-tetrafluoroethoxymethoxy)butane (PubChem CID 23529538) has the molecular formula C11H8F16O3 and a molecular weight of 492.15 g/mol. Its IUPAC name is 2-[difluoro(1,1,2-trifluoropropoxy)methyl]-1,1,1,2,4,4,4-heptafluoro-3-(1,2,2,2-tetrafluoroethoxymethoxy)butane.
| Compound Name | 2-[difluoro(1,1,2-trifluoropropoxy)methyl]-1,1,1,2,4,4,4-heptafluoro-3-(1,2,2,2-tetrafluoroethoxymethoxy)butane |
|---|---|
| PubChem CID | 23529538 |
| Molecular Formula | C11H8F16O3 |
| Molecular Weight | 492.15 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 2-[difluoro(1,1,2-trifluoropropoxy)methyl]-1,1,1,2,4,4,4-heptafluoro-3-(1,2,2,2-tetrafluoroethoxymethoxy)butane |
| SMILES | CC(F)C(F)(F)OC(F)(F)C(F)(C(OCOC(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F16O3/c1-3(12)9(21,22)30-11(26,27)6(14,10(23,24)25)4(7(15,16)17)28-2-29-5(13)8(18,19)20/h3-5H,2H2,1H3 |
| InChIKey | YJPDGHUZGFREML-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.15 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|