About CID 23529688
CID 23529688 (PubChem CID 23529688) has the molecular formula C5H8BCl2NO
and a molecular weight of 179.84 g/mol.
Molecular Properties
| Compound Name | CID 23529688 |
| PubChem CID | 23529688 |
| Molecular Formula | C5H8BCl2NO |
| Molecular Weight | 179.84 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N(CCCl)CCCl |
| InChI | InChI=1S/C5H8BCl2NO/c6-5(10)9(3-1-7)4-2-8/h1-4H2 |
| InChIKey | LVPLELFBCMSHCR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.84 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23529688 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23529688?
The IUPAC name of CID 23529688 (CID 23529688) is not available.
What is the SMILES notation for CID 23529688?
The canonical SMILES for CID 23529688 is [B]C(=O)N(CCCl)CCCl.
What is the InChIKey of CID 23529688?
The InChIKey is LVPLELFBCMSHCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BCl2NO/c6-5(10)9(3-1-7)4-2-8/h1-4H2.
What are the key properties of CID 23529688?
CID 23529688 has a molecular weight of 179.84 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23529688 is sourced from PubChem (CID 23529688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).