About 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane
1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane (PubChem CID 23529862) has the molecular formula C10H16O2S2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane.
Molecular Properties
| Compound Name | 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane |
| PubChem CID | 23529862 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane |
| SMILES | C1COC2(CCC3(CC2)SCCS3)O1 |
| InChI | InChI=1S/C10H16O2S2/c1-3-10(13-7-8-14-10)4-2-9(1)11-5-6-12-9/h1-8H2 |
| InChIKey | APPKHFXWULCLJX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane?
The IUPAC name of 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane (CID 23529862) is 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane.
What is the SMILES notation for 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane?
The canonical SMILES for 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane is C1COC2(CCC3(CC2)SCCS3)O1.
What is the InChIKey of 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane?
The InChIKey is APPKHFXWULCLJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S2/c1-3-10(13-7-8-14-10)4-2-9(1)11-5-6-12-9/h1-8H2.
What are the key properties of 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane?
1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane has a molecular weight of 232.37 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxa-9,12-dithiadispiro[4.2.48.25]tetradecane is sourced from PubChem (CID 23529862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).