C22H25F7O3 — CID 23530186
2-[1-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]-5-(4-methylcyclohexyl)-1,3-dioxane (PubChem CID 23530186) has the molecular formula C22H25F7O3 and a molecular weight of 470.43 g/mol. Its IUPAC name is 2-[1-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]-5-(4-methylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[1-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 23530186 |
| Molecular Formula | C22H25F7O3 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[1-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
| SMILES | C=C(c1ccc(OC(F)C(F)(F)C(F)(F)F)c(F)c1)C1OCC(C2CCC(C)CC2)CO1 |
| InChI | InChI=1S/C22H25F7O3/c1-12-3-5-14(6-4-12)16-10-30-19(31-11-16)13(2)15-7-8-18(17(23)9-15)32-20(24)21(25,26)22(27,28)29/h7-9,12,14,16,19-20H,2-6,10-11H2,1H3 |
| InChIKey | FAENHKNXQSXRTP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|