C52H66N4O2 — CID 23530272
2,5-bis[(3,5-ditert-butylphenyl)methyl]-1,4-bis[4-(dimethylamino)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 23530272) has the molecular formula C52H66N4O2 and a molecular weight of 779.13 g/mol. Its IUPAC name is 2,5-bis[(3,5-ditert-butylphenyl)methyl]-1,4-bis[4-(dimethylamino)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis[(3,5-ditert-butylphenyl)methyl]-1,4-bis[4-(dimethylamino)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 23530272 |
| Molecular Formula | C52H66N4O2 |
| Molecular Weight | 779.13 g/mol |
| Exact Mass | 778.52 |
| IUPAC Name | 2,5-bis[(3,5-ditert-butylphenyl)methyl]-1,4-bis[4-(dimethylamino)phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CN(C)c1ccc(C2=C3C(=O)N(Cc4cc(C(C)(C)C)cc(C(C)(C)C)c4)C(c4ccc(N(C)C)cc4)=C3C(=O)N2Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C52H66N4O2/c1-49(2,3)37-25-33(26-38(29-37)50(4,5)6)31-55-45(35-17-21-41(22-18-35)53(13)14)43-44(47(55)57)46(36-19-23-42(24-20-36)54(15)16)56(48(43)58)32-34-27-39(51(7,8)9)30-40(28-34)52(10,11)12/h17-30H,31-32H2,1-16H3 |
| InChIKey | CXHGAOLRNVDCCN-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.13 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|