About 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane
4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane (PubChem CID 23530526) has the molecular formula C12H22S
and a molecular weight of 198.38 g/mol. Its IUPAC name is 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane.
Molecular Properties
| Compound Name | 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane |
| PubChem CID | 23530526 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane |
| SMILES | CC=C1CC(C)C(C)(SC)C(C)C1 |
| InChI | InChI=1S/C12H22S/c1-6-11-7-9(2)12(4,13-5)10(3)8-11/h6,9-10H,7-8H2,1-5H3/b11-6- |
| InChIKey | PMIZTBVSDDIEOV-WDZFZDKYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane?
The IUPAC name of 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane (CID 23530526) is 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane.
What is the SMILES notation for 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane?
The canonical SMILES for 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane is CC=C1CC(C)C(C)(SC)C(C)C1.
What is the InChIKey of 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane?
The InChIKey is PMIZTBVSDDIEOV-WDZFZDKYSA-N. The full InChI is InChI=1S/C12H22S/c1-6-11-7-9(2)12(4,13-5)10(3)8-11/h6,9-10H,7-8H2,1-5H3/b11-6-.
What are the key properties of 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane?
4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane has a molecular weight of 198.38 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylidene-1,2,6-trimethyl-1-methylsulfanylcyclohexane is sourced from PubChem (CID 23530526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).