About 4-tert-butyl-2,3-dichlorobenzenethiol
4-tert-butyl-2,3-dichlorobenzenethiol (PubChem CID 23530910) has the molecular formula C10H12Cl2S
and a molecular weight of 235.18 g/mol. Its IUPAC name is 4-tert-butyl-2,3-dichlorobenzenethiol.
Molecular Properties
| Compound Name | 4-tert-butyl-2,3-dichlorobenzenethiol |
| PubChem CID | 23530910 |
| Molecular Formula | C10H12Cl2S |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 4-tert-butyl-2,3-dichlorobenzenethiol |
| SMILES | CC(C)(C)c1ccc(S)c(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl2S/c1-10(2,3)6-4-5-7(13)9(12)8(6)11/h4-5,13H,1-3H3 |
| InChIKey | QBSJTKDWZHONRM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2,3-dichlorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,3-dichlorobenzenethiol?
The IUPAC name of 4-tert-butyl-2,3-dichlorobenzenethiol (CID 23530910) is 4-tert-butyl-2,3-dichlorobenzenethiol.
What is the SMILES notation for 4-tert-butyl-2,3-dichlorobenzenethiol?
The canonical SMILES for 4-tert-butyl-2,3-dichlorobenzenethiol is CC(C)(C)c1ccc(S)c(Cl)c1Cl.
What is the InChIKey of 4-tert-butyl-2,3-dichlorobenzenethiol?
The InChIKey is QBSJTKDWZHONRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2S/c1-10(2,3)6-4-5-7(13)9(12)8(6)11/h4-5,13H,1-3H3.
What are the key properties of 4-tert-butyl-2,3-dichlorobenzenethiol?
4-tert-butyl-2,3-dichlorobenzenethiol has a molecular weight of 235.18 g/mol, XLogP of 4.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,3-dichlorobenzenethiol is sourced from PubChem (CID 23530910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).