C38H52O11 — CID 23531127
ditert-butyl 5-[2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoyl]oxyadamantane-1,3-dicarboxylate (PubChem CID 23531127) has the molecular formula C38H52O11 and a molecular weight of 684.82 g/mol. Its IUPAC name is ditert-butyl 5-[2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoyl]oxyadamantane-1,3-dicarboxylate.
| Compound Name | ditert-butyl 5-[2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoyl]oxyadamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23531127 |
| Molecular Formula | C38H52O11 |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | ditert-butyl 5-[2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoyl]oxyadamantane-1,3-dicarboxylate |
| SMILES | CC1C(=O)OC(=O)C1C(CC1C(C)C2CC1C1COC(=O)C21)C(=O)OC12CC3CC(C(=O)OC(C)(C)C)(C1)CC(C(=O)OC(C)(C)C)(C3)C2 |
| InChI | InChI=1S/C38H52O11/c1-18-21(23-10-22(18)27-25(23)14-45-30(27)41)9-24(26-19(2)28(39)46-31(26)42)29(40)47-38-13-20-11-36(16-38,32(43)48-34(3,4)5)15-37(12-20,17-38)33(44)49-35(6,7)8/h18-27H,9-17H2,1-8H3 |
| InChIKey | GNYHSDOGIXWBAF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|