C31H42O7 — CID 23531129
2-(1-adamantyl)propan-2-yl 2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoate (PubChem CID 23531129) has the molecular formula C31H42O7 and a molecular weight of 526.67 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoate |
|---|---|
| PubChem CID | 23531129 |
| Molecular Formula | C31H42O7 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(9-methyl-3-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)propanoate |
| SMILES | CC1C(=O)OC(=O)C1C(CC1C(C)C2CC1C1COC(=O)C21)C(=O)OC(C)(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H42O7/c1-14-19(21-9-20(14)25-23(21)13-36-28(25)34)8-22(24-15(2)26(32)37-29(24)35)27(33)38-30(3,4)31-10-16-5-17(11-31)7-18(6-16)12-31/h14-25H,5-13H2,1-4H3 |
| InChIKey | JSUUNVXMOGQJQI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|