C18H21F3N2 — CID 23532179
2,11-dimethyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 23532179) has the molecular formula C18H21F3N2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2,11-dimethyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | 2,11-dimethyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 23532179 |
| Molecular Formula | C18H21F3N2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2,11-dimethyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | CC1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(C)CC21 |
| InChI | InChI=1S/C18H21F3N2/c1-10-14-9-23(2)6-5-11(14)7-16-17(10)13-8-12(18(19,20)21)3-4-15(13)22-16/h3-4,8,10-11,14,22H,5-7,9H2,1-2H3 |
| InChIKey | BJYHYLQKUMWFQA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|