C23H30F3N3O — CID 23532181
4-[2-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholine (PubChem CID 23532181) has the molecular formula C23H30F3N3O and a molecular weight of 421.51 g/mol. Its IUPAC name is 4-[2-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholine.
| Compound Name | 4-[2-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 23532181 |
| Molecular Formula | C23H30F3N3O |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-[2-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholine |
| SMILES | CC1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(CCN3CCOCC3)CC21 |
| InChI | InChI=1S/C23H30F3N3O/c1-15-19-14-29(7-6-28-8-10-30-11-9-28)5-4-16(19)12-21-22(15)18-13-17(23(24,25)26)2-3-20(18)27-21/h2-3,13,15-16,19,27H,4-12,14H2,1H3 |
| InChIKey | OQOGMEFNRHFVDB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|