About 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane
3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane (PubChem CID 23532207) has the molecular formula C8H12N2P2
and a molecular weight of 198.15 g/mol. Its IUPAC name is 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane.
Molecular Properties
| Compound Name | 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane |
| PubChem CID | 23532207 |
| Molecular Formula | C8H12N2P2 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane |
| SMILES | PPN1CCc2cnccc2C1 |
| InChI | InChI=1S/C8H12N2P2/c11-12-10-4-2-7-5-9-3-1-8(7)6-10/h1,3,5,12H,2,4,6,11H2 |
| InChIKey | UEEOISYPGHVLHT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane?
The IUPAC name of 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane (CID 23532207) is 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane.
What is the SMILES notation for 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane?
The canonical SMILES for 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane is PPN1CCc2cnccc2C1.
What is the InChIKey of 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane?
The InChIKey is UEEOISYPGHVLHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2P2/c11-12-10-4-2-7-5-9-3-1-8(7)6-10/h1,3,5,12H,2,4,6,11H2.
What are the key properties of 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane?
3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane has a molecular weight of 198.15 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1H-2,6-naphthyridin-2-yl(phosphanyl)phosphane is sourced from PubChem (CID 23532207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).