About N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide
N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide (PubChem CID 23532322) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide.
Molecular Properties
| Compound Name | N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide |
| PubChem CID | 23532322 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide |
| SMILES | CC(=O)C(=O)NCC1=CCC=C1 |
| InChI | InChI=1S/C9H11NO2/c1-7(11)9(12)10-6-8-4-2-3-5-8/h2,4-5H,3,6H2,1H3,(H,10,12) |
| InChIKey | IYVAMGDRSAWEFT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide?
The IUPAC name of N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide (CID 23532322) is N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide.
What is the SMILES notation for N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide?
The canonical SMILES for N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide is CC(=O)C(=O)NCC1=CCC=C1.
What is the InChIKey of N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide?
The InChIKey is IYVAMGDRSAWEFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-7(11)9(12)10-6-8-4-2-3-5-8/h2,4-5H,3,6H2,1H3,(H,10,12).
What are the key properties of N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide?
N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide has a molecular weight of 165.19 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopenta-1,4-dien-1-ylmethyl)-2-oxopropanamide is sourced from PubChem (CID 23532322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).