C27H20Br2Cl2FN3O2 — CID 23532584
1-[[4,6-dibromo-2-(4-fluorophenyl)-3-pyridinyl]methyl]-3-(2,6-dichlorophenyl)-1-[(4-methoxyphenyl)methyl]urea (PubChem CID 23532584) has the molecular formula C27H20Br2Cl2FN3O2 and a molecular weight of 668.19 g/mol. Its IUPAC name is 1-[[4,6-dibromo-2-(4-fluorophenyl)-3-pyridinyl]methyl]-3-(2,6-dichlorophenyl)-1-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[[4,6-dibromo-2-(4-fluorophenyl)-3-pyridinyl]methyl]-3-(2,6-dichlorophenyl)-1-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 23532584 |
| Molecular Formula | C27H20Br2Cl2FN3O2 |
| Molecular Weight | 668.19 g/mol |
| Exact Mass | 664.93 |
| IUPAC Name | 1-[[4,6-dibromo-2-(4-fluorophenyl)-3-pyridinyl]methyl]-3-(2,6-dichlorophenyl)-1-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(Cc2c(Br)cc(Br)nc2-c2ccc(F)cc2)C(=O)Nc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C27H20Br2Cl2FN3O2/c1-37-19-11-5-16(6-12-19)14-35(27(36)34-26-22(30)3-2-4-23(26)31)15-20-21(28)13-24(29)33-25(20)17-7-9-18(32)10-8-17/h2-13H,14-15H2,1H3,(H,34,36) |
| InChIKey | WIJNWSBJDUYQGW-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.19 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|