About tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane
tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane (PubChem CID 23532914) has the molecular formula C21H43NSn
and a molecular weight of 428.29 g/mol. Its IUPAC name is tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane |
| PubChem CID | 23532914 |
| Molecular Formula | C21H43NSn |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C9H16N.3C4H9.Sn/c1-9(2,3)10-7-5-4-6-8-10;3*1-3-4-2;/h5H,6-8H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | CLELMPOMKBCKHU-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane?
The IUPAC name of tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane (CID 23532914) is tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane.
What is the SMILES notation for tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane?
The canonical SMILES for tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane is CCCC[Sn](CCCC)(CCCC)C1=CCN(C(C)(C)C)CC1.
What is the InChIKey of tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane?
The InChIKey is CLELMPOMKBCKHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N.3C4H9.Sn/c1-9(2,3)10-7-5-4-6-8-10;3*1-3-4-2;/h5H,6-8H2,1-3H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane?
tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane has a molecular weight of 428.29 g/mol, XLogP of 6.81, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(1-tert-butyl-3,6-dihydro-2H-pyridin-4-yl)stannane is sourced from PubChem (CID 23532914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).