C22H30F3N3O5 — CID 23533691
tert-butyl N-[3-(1-hydroxyethyl)-3-[1-oxido-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carbonyl]cyclopentyl]carbamate (PubChem CID 23533691) has the molecular formula C22H30F3N3O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is tert-butyl N-[3-(1-hydroxyethyl)-3-[1-oxido-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carbonyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-(1-hydroxyethyl)-3-[1-oxido-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carbonyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 23533691 |
| Molecular Formula | C22H30F3N3O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | tert-butyl N-[3-(1-hydroxyethyl)-3-[1-oxido-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carbonyl]cyclopentyl]carbamate |
| SMILES | CC(O)C1(C(=O)N2CCc3c(cc(C(F)(F)F)c[n+]3[O-])C2)CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H30F3N3O5/c1-13(29)21(7-5-16(10-21)26-19(31)33-20(2,3)4)18(30)27-8-6-17-14(11-27)9-15(12-28(17)32)22(23,24)25/h9,12-13,16,29H,5-8,10-11H2,1-4H3,(H,26,31) |
| InChIKey | TUCOCMIOXOYYJZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|