C17H14F3NO4 — CID 2353376
[2-(benzylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate (PubChem CID 2353376) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2353376 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 4-(trifluoromethoxy)benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC(F)(F)F)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C17H14F3NO4/c18-17(19,20)25-14-8-6-13(7-9-14)16(23)24-11-15(22)21-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,21,22) |
| InChIKey | NPSQUFVXHICQQS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |