C28H28N4 — CID 23534201
2,3,7,8,12,13,17,18-octamethylporphyrin (PubChem CID 23534201) has the molecular formula C28H28N4 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octamethylporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octamethylporphyrin |
|---|---|
| PubChem CID | 23534201 |
| Molecular Formula | C28H28N4 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octamethylporphyrin |
| SMILES | CC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(C)=C5C)C(C)=C4C)C(C)=C3C |
| InChI | InChI=1S/C28H28N4/c1-13-14(2)22-10-24-17(5)18(6)26(31-24)12-28-20(8)19(7)27(32-28)11-25-16(4)15(3)23(30-25)9-21(13)29-22/h9-12H,1-8H3/b21-9-,22-10-,23-9-,24-10-,25-11-,26-12-,27-11-,28-12- |
| InChIKey | TWJBBHGCSRQHHY-UCLSOATESA-N |
| XLogP | 6.70 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |