About 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine
4-methylidene-1-(1,2,4-triazol-4-yl)pyridine (PubChem CID 23534348) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine.
Molecular Properties
| Compound Name | 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine |
| PubChem CID | 23534348 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine |
| SMILES | C=C1C=CN(n2cnnc2)C=C1 |
| InChI | InChI=1S/C8H8N4/c1-8-2-4-11(5-3-8)12-6-9-10-7-12/h2-7H,1H2 |
| InChIKey | KCZAVDCFNDSZSQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine?
The IUPAC name of 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine (CID 23534348) is 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine.
What is the SMILES notation for 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine?
The canonical SMILES for 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine is C=C1C=CN(n2cnnc2)C=C1.
What is the InChIKey of 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine?
The InChIKey is KCZAVDCFNDSZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c1-8-2-4-11(5-3-8)12-6-9-10-7-12/h2-7H,1H2.
What are the key properties of 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine?
4-methylidene-1-(1,2,4-triazol-4-yl)pyridine has a molecular weight of 160.18 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-1-(1,2,4-triazol-4-yl)pyridine is sourced from PubChem (CID 23534348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).