About 8-methylidene-1,2,3,4-tetrahydroquinolizine
8-methylidene-1,2,3,4-tetrahydroquinolizine (PubChem CID 23534387) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 8-methylidene-1,2,3,4-tetrahydroquinolizine.
Molecular Properties
| Compound Name | 8-methylidene-1,2,3,4-tetrahydroquinolizine |
| PubChem CID | 23534387 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 8-methylidene-1,2,3,4-tetrahydroquinolizine |
| SMILES | C=C1C=CN2CCCCC2=C1 |
| InChI | InChI=1S/C10H13N/c1-9-5-7-11-6-3-2-4-10(11)8-9/h5,7-8H,1-4,6H2 |
| InChIKey | WRCQTQGZUQWPCL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methylidene-1,2,3,4-tetrahydroquinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylidene-1,2,3,4-tetrahydroquinolizine?
The IUPAC name of 8-methylidene-1,2,3,4-tetrahydroquinolizine (CID 23534387) is 8-methylidene-1,2,3,4-tetrahydroquinolizine.
What is the SMILES notation for 8-methylidene-1,2,3,4-tetrahydroquinolizine?
The canonical SMILES for 8-methylidene-1,2,3,4-tetrahydroquinolizine is C=C1C=CN2CCCCC2=C1.
What is the InChIKey of 8-methylidene-1,2,3,4-tetrahydroquinolizine?
The InChIKey is WRCQTQGZUQWPCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-9-5-7-11-6-3-2-4-10(11)8-9/h5,7-8H,1-4,6H2.
What are the key properties of 8-methylidene-1,2,3,4-tetrahydroquinolizine?
8-methylidene-1,2,3,4-tetrahydroquinolizine has a molecular weight of 147.22 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylidene-1,2,3,4-tetrahydroquinolizine is sourced from PubChem (CID 23534387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).