C44H36N2 — CID 23534540
3-N,3-N,8-N,8-N-tetrakis(4-methylphenyl)fluoranthene-3,8-diamine (PubChem CID 23534540) has the molecular formula C44H36N2 and a molecular weight of 592.79 g/mol. Its IUPAC name is 3-N,3-N,8-N,8-N-tetrakis(4-methylphenyl)fluoranthene-3,8-diamine.
| Compound Name | 3-N,3-N,8-N,8-N-tetrakis(4-methylphenyl)fluoranthene-3,8-diamine |
|---|---|
| PubChem CID | 23534540 |
| Molecular Formula | C44H36N2 |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | 3-N,3-N,8-N,8-N-tetrakis(4-methylphenyl)fluoranthene-3,8-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)-c2cccc4c(N(c5ccc(C)cc5)c5ccc(C)cc5)ccc-3c24)cc1 |
| InChI | InChI=1S/C44H36N2/c1-29-8-16-33(17-9-29)45(34-18-10-30(2)11-19-34)37-24-25-38-40-26-27-43(41-7-5-6-39(44(40)41)42(38)28-37)46(35-20-12-31(3)13-21-35)36-22-14-32(4)15-23-36/h5-28H,1-4H3 |
| InChIKey | WWRHEVAWKMMOML-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |