C13H14F12O — CID 23534663
1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-ol (PubChem CID 23534663) has the molecular formula C13H14F12O and a molecular weight of 414.23 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 23534663 |
| Molecular Formula | C13H14F12O |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-ol |
| SMILES | CC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H14F12O/c1-8(10(14,15)16,11(17,18)19)6-2-4-7(5-3-6)9(26,12(20,21)22)13(23,24)25/h6-7,26H,2-5H2,1H3 |
| InChIKey | GAJMPKKXVLNGPJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |